C15H19F3N4O — CID 157088493
(3S)-4,4,4-trifluoro-3-methyl-1-[(9S)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-yl]butan-1-one (PubChem CID 157088493) has the molecular formula C15H19F3N4O and a molecular weight of 328.34 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-methyl-1-[(9S)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-yl]butan-1-one.
| Compound Name | (3S)-4,4,4-trifluoro-3-methyl-1-[(9S)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-yl]butan-1-one |
|---|---|
| PubChem CID | 157088493 |
| Molecular Formula | C15H19F3N4O |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-methyl-1-[(9S)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-yl]butan-1-one |
| SMILES | Cc1nc(C(=O)C[C@H](C)C(F)(F)F)nc2c1N1CCC[C@@H](C1)N2 |
| InChI | InChI=1S/C15H19F3N4O/c1-8(15(16,17)18)6-11(23)13-19-9(2)12-14(21-13)20-10-4-3-5-22(12)7-10/h8,10H,3-7H2,1-2H3,(H,19,20,21)/t8-,10-/m0/s1 |
| InChIKey | ZJDWWKKEYOBOHR-WPRPVWTQSA-N |
| XLogP | 2.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |