About 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium
5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium (PubChem CID 157089352) has the molecular formula C10H11F3NOY-
and a molecular weight of 307.10 g/mol. Its IUPAC name is 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium.
Molecular Properties
| Compound Name | 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium |
| PubChem CID | 157089352 |
| Molecular Formula | C10H11F3NOY- |
| Molecular Weight | 307.10 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium |
| SMILES | C=C1C(OC)=CC(C)=[C-]N1CC(F)(F)F.[Y] |
| InChI | InChI=1S/C10H11F3NO.Y/c1-7-4-9(15-3)8(2)14(5-7)6-10(11,12)13;/h4H,2,6H2,1,3H3;/q-1; |
| InChIKey | ZUZVWGFQZRFUSC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.10 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium?
The IUPAC name of 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium (CID 157089352) is 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium.
What is the SMILES notation for 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium?
The canonical SMILES for 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium is C=C1C(OC)=CC(C)=[C-]N1CC(F)(F)F.[Y].
What is the InChIKey of 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium?
The InChIKey is ZUZVWGFQZRFUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3NO.Y/c1-7-4-9(15-3)8(2)14(5-7)6-10(11,12)13;/h4H,2,6H2,1,3H3;/q-1;.
What are the key properties of 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium?
5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium has a molecular weight of 307.10 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium is sourced from PubChem (CID 157089352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).