About 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride
3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride (PubChem CID 157089662) has the molecular formula C13H28Cl2F2N4
and a molecular weight of 349.30 g/mol. Its IUPAC name is 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride.
Molecular Properties
| Compound Name | 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride |
| PubChem CID | 157089662 |
| Molecular Formula | C13H28Cl2F2N4 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride |
| SMILES | CN1CCN(C2CCCNC2)CC1.Cl.Cl.FC1(F)CNC1 |
| InChI | InChI=1S/C10H21N3.C3H5F2N.2ClH/c1-12-5-7-13(8-6-12)10-3-2-4-11-9-10;4-3(5)1-6-2-3;;/h10-11H,2-9H2,1H3;6H,1-2H2;2*1H |
| InChIKey | SSNSSLDQDOLXPA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride?
The IUPAC name of 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride (CID 157089662) is 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride.
What is the SMILES notation for 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride?
The canonical SMILES for 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride is CN1CCN(C2CCCNC2)CC1.Cl.Cl.FC1(F)CNC1.
What is the InChIKey of 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride?
The InChIKey is SSNSSLDQDOLXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3.C3H5F2N.2ClH/c1-12-5-7-13(8-6-12)10-3-2-4-11-9-10;4-3(5)1-6-2-3;;/h10-11H,2-9H2,1H3;6H,1-2H2;2*1H.
What are the key properties of 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride?
3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride has a molecular weight of 349.30 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoroazetidine;1-methyl-4-piperidin-3-ylpiperazine;dihydrochloride is sourced from PubChem (CID 157089662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).