About 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane
2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane (PubChem CID 157090802) has the molecular formula C27H28FNO6S2
and a molecular weight of 545.65 g/mol. Its IUPAC name is 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane.
Molecular Properties
| Compound Name | 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane |
| PubChem CID | 157090802 |
| Molecular Formula | C27H28FNO6S2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane |
| SMILES | C1CCOC1.Cc1ccc(S(=O)(=O)OCCc2cccc3[nH]cc(S(=O)(=O)c4cccc(F)c4)c23)cc1 |
| InChI | InChI=1S/C23H20FNO5S2.C4H8O/c1-16-8-10-19(11-9-16)32(28,29)30-13-12-17-4-2-7-21-23(17)22(15-25-21)31(26,27)20-6-3-5-18(24)14-20;1-2-4-5-3-1/h2-11,14-15,25H,12-13H2,1H3;1-4H2 |
| InChIKey | AEQFLGGWXBYINX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane?
The IUPAC name of 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane (CID 157090802) is 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane.
What is the SMILES notation for 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane?
The canonical SMILES for 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane is C1CCOC1.Cc1ccc(S(=O)(=O)OCCc2cccc3[nH]cc(S(=O)(=O)c4cccc(F)c4)c23)cc1.
What is the InChIKey of 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane?
The InChIKey is AEQFLGGWXBYINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FNO5S2.C4H8O/c1-16-8-10-19(11-9-16)32(28,29)30-13-12-17-4-2-7-21-23(17)22(15-25-21)31(26,27)20-6-3-5-18(24)14-20;1-2-4-5-3-1/h2-11,14-15,25H,12-13H2,1H3;1-4H2.
What are the key properties of 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane?
2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane has a molecular weight of 545.65 g/mol, XLogP of 5.19, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate;oxolane is sourced from PubChem (CID 157090802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).