C31H40N12O6 — CID 157091143
(2R,3S,4R,5R)-5-[6-amino-2-[4-[[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethylamino]methyl]anilino]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 157091143) has the molecular formula C31H40N12O6 and a molecular weight of 676.74 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-[6-amino-2-[4-[[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethylamino]methyl]anilino]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2R,3S,4R,5R)-5-[6-amino-2-[4-[[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethylamino]methyl]anilino]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 157091143 |
| Molecular Formula | C31H40N12O6 |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 676.32 |
| IUPAC Name | (2R,3S,4R,5R)-5-[6-amino-2-[4-[[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethylamino]methyl]anilino]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1O[C@@H](n2cnc3c(N)nc(Nc4ccc(CNCCc5nc6c(c(=O)n(CC)c(=O)n6CC)n5C)cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H40N12O6/c1-5-34-27(46)23-21(44)22(45)29(49-23)43-15-35-19-24(32)38-30(39-25(19)43)36-17-10-8-16(9-11-17)14-33-13-12-18-37-26-20(40(18)4)28(47)42(7-3)31(48)41(26)6-2/h8-11,15,21-23,29,33,44-45H,5-7,12-14H2,1-4H3,(H,34,46)(H3,32,36,38,39)/t21-,22+,23+,29+/m0/s1 |
| InChIKey | AERHEKOIEORYNT-KAMGSVSWSA-N |
| XLogP | -0.51 |
| TPSA | 234.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|