C22H33NO7 — CID 157093627
cyclobutane;prop-1-yne;(3,4,5-trihydroxy-6-methyloxan-2-yl) N-[4-(methoxymethyl)phenyl]carbamate (PubChem CID 157093627) has the molecular formula C22H33NO7 and a molecular weight of 423.51 g/mol. Its IUPAC name is cyclobutane;prop-1-yne;(3,4,5-trihydroxy-6-methyloxan-2-yl) N-[4-(methoxymethyl)phenyl]carbamate.
| Compound Name | cyclobutane;prop-1-yne;(3,4,5-trihydroxy-6-methyloxan-2-yl) N-[4-(methoxymethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 157093627 |
| Molecular Formula | C22H33NO7 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | cyclobutane;prop-1-yne;(3,4,5-trihydroxy-6-methyloxan-2-yl) N-[4-(methoxymethyl)phenyl]carbamate |
| SMILES | C#CC.C1CCC1.COCc1ccc(NC(=O)OC2OC(C)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C15H21NO7.C4H8.C3H4/c1-8-11(17)12(18)13(19)14(22-8)23-15(20)16-10-5-3-9(4-6-10)7-21-2;1-2-4-3-1;1-3-2/h3-6,8,11-14,17-19H,7H2,1-2H3,(H,16,20);1-4H2;1H,2H3 |
| InChIKey | AEYIHYKKBRQXJJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|