C36H29Br3EuN2O3 — CID 157093667
tris(1-(4-bromophenyl)ethanone);europium;1,10-phenanthroline (PubChem CID 157093667) has the molecular formula C36H29Br3EuN2O3 and a molecular weight of 929.31 g/mol. Its IUPAC name is tris(1-(4-bromophenyl)ethanone);europium;1,10-phenanthroline.
| Compound Name | tris(1-(4-bromophenyl)ethanone);europium;1,10-phenanthroline |
|---|---|
| PubChem CID | 157093667 |
| Molecular Formula | C36H29Br3EuN2O3 |
| Molecular Weight | 929.31 g/mol |
| Exact Mass | 926.89 |
| IUPAC Name | tris(1-(4-bromophenyl)ethanone);europium;1,10-phenanthroline |
| SMILES | CC(=O)c1ccc(Br)cc1.CC(=O)c1ccc(Br)cc1.CC(=O)c1ccc(Br)cc1.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C8H7BrO.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*1-6(10)7-2-4-8(9)5-3-7;/h1-8H;3*2-5H,1H3; |
| InChIKey | AEYKYGOPHXHZDP-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.31 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|