chloric acid

H3Cl3O9 — CID 157094487

IUPACchloric acid
SMILES[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O
InChIInChI=1S/3ClHO3/c3*2-1(3)4/h3*2H
InChIKeyZKJHHJFHXMGNGP-UHFFFAOYSA-N
MW253.37 g/mol
LogP-8.81
Rot. Bonds

About chloric acid

chloric acid (PubChem CID 157094487) has the molecular formula H3Cl3O9 and a molecular weight of 253.37 g/mol. Its IUPAC name is chloric acid.

Molecular Properties

Compound Namechloric acid
PubChem CID157094487
Molecular FormulaH3Cl3O9
Molecular Weight253.37 g/mol
Exact Mass251.88
IUPAC Namechloric acid
SMILES[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O
InChIInChI=1S/3ClHO3/c3*2-1(3)4/h3*2H
InChIKeyZKJHHJFHXMGNGP-UHFFFAOYSA-N
XLogP-8.81
TPSA199.05 Ų
H-Bond Donors3
H-Bond Acceptors9
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.37
LogP ≤ 5-8.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 109

Analyze chloric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloric acid?
The IUPAC name of chloric acid (CID 157094487) is chloric acid.
What is the SMILES notation for chloric acid?
The canonical SMILES for chloric acid is [O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.
What is the InChIKey of chloric acid?
The InChIKey is ZKJHHJFHXMGNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/3ClHO3/c3*2-1(3)4/h3*2H.
What are the key properties of chloric acid?
chloric acid has a molecular weight of 253.37 g/mol, XLogP of -8.81, 0 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for chloric acid is sourced from PubChem (CID 157094487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).