About dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate
dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate (PubChem CID 157094807) has the molecular formula C14H22O8Si2
and a molecular weight of 374.49 g/mol. Its IUPAC name is dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate.
Molecular Properties
| Compound Name | dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate |
| PubChem CID | 157094807 |
| Molecular Formula | C14H22O8Si2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate |
| SMILES | COC(=O)c1ccc(OCCC[Si](OC)(OC)OC)cc1.O=[Si]=O |
| InChI | InChI=1S/C14H22O6Si.O2Si/c1-16-14(15)12-6-8-13(9-7-12)20-10-5-11-21(17-2,18-3)19-4;1-3-2/h6-9H,5,10-11H2,1-4H3; |
| InChIKey | AFBUGELJXQWNIP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate?
The IUPAC name of dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate (CID 157094807) is dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate.
What is the SMILES notation for dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate?
The canonical SMILES for dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate is COC(=O)c1ccc(OCCC[Si](OC)(OC)OC)cc1.O=[Si]=O.
What is the InChIKey of dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate?
The InChIKey is AFBUGELJXQWNIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O6Si.O2Si/c1-16-14(15)12-6-8-13(9-7-12)20-10-5-11-21(17-2,18-3)19-4;1-3-2/h6-9H,5,10-11H2,1-4H3;.
What are the key properties of dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate?
dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate has a molecular weight of 374.49 g/mol, XLogP of 1.50, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dioxosilane;methyl 4-(3-trimethoxysilylpropoxy)benzoate is sourced from PubChem (CID 157094807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).