About 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane
1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane (PubChem CID 157094881) has the molecular formula C22H33F3O
and a molecular weight of 370.50 g/mol. Its IUPAC name is 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane.
Molecular Properties
| Compound Name | 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane |
| PubChem CID | 157094881 |
| Molecular Formula | C22H33F3O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane |
| SMILES | CCOC1CCC(C2CCC(CCF)CC2)CC1.Fc1cccc(F)c1 |
| InChI | InChI=1S/C16H29FO.C6H4F2/c1-2-18-16-9-7-15(8-10-16)14-5-3-13(4-6-14)11-12-17;7-5-2-1-3-6(8)4-5/h13-16H,2-12H2,1H3;1-4H |
| InChIKey | AFCAIYPVMMADFB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane?
The IUPAC name of 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane (CID 157094881) is 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane.
What is the SMILES notation for 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane?
The canonical SMILES for 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane is CCOC1CCC(C2CCC(CCF)CC2)CC1.Fc1cccc(F)c1.
What is the InChIKey of 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane?
The InChIKey is AFCAIYPVMMADFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29FO.C6H4F2/c1-2-18-16-9-7-15(8-10-16)14-5-3-13(4-6-14)11-12-17;7-5-2-1-3-6(8)4-5/h13-16H,2-12H2,1H3;1-4H.
What are the key properties of 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane?
1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane has a molecular weight of 370.50 g/mol, XLogP of 6.71, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluorobenzene;1-ethoxy-4-[4-(2-fluoroethyl)cyclohexyl]cyclohexane is sourced from PubChem (CID 157094881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).