C33H40N4O5SSi — CID 157095061
5-[2-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl]-4-pyridinyl]-N-[3-(2-nitrophenyl)sulfonylpropyl]pyridin-2-amine (PubChem CID 157095061) has the molecular formula C33H40N4O5SSi and a molecular weight of 632.86 g/mol. Its IUPAC name is 5-[2-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl]-4-pyridinyl]-N-[3-(2-nitrophenyl)sulfonylpropyl]pyridin-2-amine.
| Compound Name | 5-[2-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl]-4-pyridinyl]-N-[3-(2-nitrophenyl)sulfonylpropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 157095061 |
| Molecular Formula | C33H40N4O5SSi |
| Molecular Weight | 632.86 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 5-[2-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl]-4-pyridinyl]-N-[3-(2-nitrophenyl)sulfonylpropyl]pyridin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(Cc2cc(-c3ccc(NCCCS(=O)(=O)c4ccccc4[N+](=O)[O-])nc3)ccn2)c1 |
| InChI | InChI=1S/C33H40N4O5SSi/c1-33(2,3)44(4,5)42-24-26-11-8-10-25(20-26)21-29-22-27(16-18-34-29)28-14-15-32(36-23-28)35-17-9-19-43(40,41)31-13-7-6-12-30(31)37(38)39/h6-8,10-16,18,20,22-23H,9,17,19,21,24H2,1-5H3,(H,35,36) |
| InChIKey | AFCOBTPJSMKLCR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.86 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|