C24H28N3O5PS — CID 157095079
1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[[ethoxy(ethyl)phosphoryl]methylsulfonyl]phenyl]ethanone (PubChem CID 157095079) has the molecular formula C24H28N3O5PS and a molecular weight of 501.55 g/mol. Its IUPAC name is 1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[[ethoxy(ethyl)phosphoryl]methylsulfonyl]phenyl]ethanone.
| Compound Name | 1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[[ethoxy(ethyl)phosphoryl]methylsulfonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 157095079 |
| Molecular Formula | C24H28N3O5PS |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[[ethoxy(ethyl)phosphoryl]methylsulfonyl]phenyl]ethanone |
| SMILES | CCO[P@](=O)(CC)CS(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc(C)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C24H28N3O5PS/c1-4-32-33(29,5-2)16-34(30,31)20-12-8-18(9-13-20)14-22(28)23-24(25)26-15-21(27-23)19-10-6-17(3)7-11-19/h6-13,15H,4-5,14,16H2,1-3H3,(H2,25,26)/t33-/m1/s1 |
| InChIKey | RAGRYQIMIABHOF-MGBGTMOVSA-N |
| XLogP | 4.53 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|