About 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid
5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid (PubChem CID 157095267) has the molecular formula C12H15IN2O6
and a molecular weight of 410.16 g/mol. Its IUPAC name is 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid |
| PubChem CID | 157095267 |
| Molecular Formula | C12H15IN2O6 |
| Molecular Weight | 410.16 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid |
| SMILES | CC(C(=O)O)C(=O)CCN(C(=O)CI)N1C(=O)CCC1=O |
| InChI | InChI=1S/C12H15IN2O6/c1-7(12(20)21)8(16)4-5-14(11(19)6-13)15-9(17)2-3-10(15)18/h7H,2-6H2,1H3,(H,20,21) |
| InChIKey | XLGXFJIJXNIGAY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid?
The IUPAC name of 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid (CID 157095267) is 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid.
What is the SMILES notation for 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid?
The canonical SMILES for 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid is CC(C(=O)O)C(=O)CCN(C(=O)CI)N1C(=O)CCC1=O.
What is the InChIKey of 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid?
The InChIKey is XLGXFJIJXNIGAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15IN2O6/c1-7(12(20)21)8(16)4-5-14(11(19)6-13)15-9(17)2-3-10(15)18/h7H,2-6H2,1H3,(H,20,21).
What are the key properties of 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid?
5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid has a molecular weight of 410.16 g/mol, XLogP of -0.01, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dioxopyrrolidin-1-yl)-(2-iodoacetyl)amino]-2-methyl-3-oxopentanoic acid is sourced from PubChem (CID 157095267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).