About methane;2-prop-2-enoxyethyl 3-oxobutanoate
methane;2-prop-2-enoxyethyl 3-oxobutanoate (PubChem CID 157095502) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is methane;2-prop-2-enoxyethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | methane;2-prop-2-enoxyethyl 3-oxobutanoate |
| PubChem CID | 157095502 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | methane;2-prop-2-enoxyethyl 3-oxobutanoate |
| SMILES | C.C.C=CCOCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C9H14O4.2CH4/c1-3-4-12-5-6-13-9(11)7-8(2)10;;/h3H,1,4-7H2,2H3;2*1H4 |
| InChIKey | AFDXJUYJVQSWAR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;2-prop-2-enoxyethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-prop-2-enoxyethyl 3-oxobutanoate?
The IUPAC name of methane;2-prop-2-enoxyethyl 3-oxobutanoate (CID 157095502) is methane;2-prop-2-enoxyethyl 3-oxobutanoate.
What is the SMILES notation for methane;2-prop-2-enoxyethyl 3-oxobutanoate?
The canonical SMILES for methane;2-prop-2-enoxyethyl 3-oxobutanoate is C.C.C=CCOCCOC(=O)CC(C)=O.
What is the InChIKey of methane;2-prop-2-enoxyethyl 3-oxobutanoate?
The InChIKey is AFDXJUYJVQSWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4.2CH4/c1-3-4-12-5-6-13-9(11)7-8(2)10;;/h3H,1,4-7H2,2H3;2*1H4.
What are the key properties of methane;2-prop-2-enoxyethyl 3-oxobutanoate?
methane;2-prop-2-enoxyethyl 3-oxobutanoate has a molecular weight of 218.29 g/mol, XLogP of 1.98, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-prop-2-enoxyethyl 3-oxobutanoate is sourced from PubChem (CID 157095502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).