C15H30N2O5S — CID 157096977
methyl (2S)-2,4-dimethyl-4-nitropentanoate;sulfane;(3S)-3,5,5-trimethylpyrrolidin-2-one (PubChem CID 157096977) has the molecular formula C15H30N2O5S and a molecular weight of 350.48 g/mol. Its IUPAC name is methyl (2S)-2,4-dimethyl-4-nitropentanoate;sulfane;(3S)-3,5,5-trimethylpyrrolidin-2-one.
| Compound Name | methyl (2S)-2,4-dimethyl-4-nitropentanoate;sulfane;(3S)-3,5,5-trimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 157096977 |
| Molecular Formula | C15H30N2O5S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | methyl (2S)-2,4-dimethyl-4-nitropentanoate;sulfane;(3S)-3,5,5-trimethylpyrrolidin-2-one |
| SMILES | COC(=O)[C@@H](C)CC(C)(C)[N+](=O)[O-].C[C@H]1CC(C)(C)NC1=O.S |
| InChI | InChI=1S/C8H15NO4.C7H13NO.H2S/c1-6(7(10)13-4)5-8(2,3)9(11)12;1-5-4-7(2,3)8-6(5)9;/h6H,5H2,1-4H3;5H,4H2,1-3H3,(H,8,9);1H2/t6-;5-;/m00./s1 |
| InChIKey | AFHZMIXOYKLTGE-MKZQLBLYSA-N |
| XLogP | 2.27 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|