C28H25ClN6 — CID 157097052
3-[2-[2-chloro-5-[5-[(4-methylpiperazin-1-yl)methyl]-3H-indol-2-yl]phenyl]ethynyl]imidazo[1,2-b]pyridazine (PubChem CID 157097052) has the molecular formula C28H25ClN6 and a molecular weight of 481.00 g/mol. Its IUPAC name is 3-[2-[2-chloro-5-[5-[(4-methylpiperazin-1-yl)methyl]-3H-indol-2-yl]phenyl]ethynyl]imidazo[1,2-b]pyridazine.
| Compound Name | 3-[2-[2-chloro-5-[5-[(4-methylpiperazin-1-yl)methyl]-3H-indol-2-yl]phenyl]ethynyl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 157097052 |
| Molecular Formula | C28H25ClN6 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 3-[2-[2-chloro-5-[5-[(4-methylpiperazin-1-yl)methyl]-3H-indol-2-yl]phenyl]ethynyl]imidazo[1,2-b]pyridazine |
| SMILES | CN1CCN(Cc2ccc3c(c2)CC(c2ccc(Cl)c(C#Cc4cnc5cccnn45)c2)=N3)CC1 |
| InChI | InChI=1S/C28H25ClN6/c1-33-11-13-34(14-12-33)19-20-4-9-26-23(15-20)17-27(32-26)22-6-8-25(29)21(16-22)5-7-24-18-30-28-3-2-10-31-35(24)28/h2-4,6,8-10,15-16,18H,11-14,17,19H2,1H3 |
| InChIKey | AFIHCCFUDPVPMF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|