C39H35BF6N4O3 — CID 157097991
CID 157097991 (PubChem CID 157097991) has the molecular formula C39H35BF6N4O3 and a molecular weight of 732.53 g/mol.
| Compound Name | CID 157097991 |
|---|---|
| PubChem CID | 157097991 |
| Molecular Formula | C39H35BF6N4O3 |
| Molecular Weight | 732.53 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | — |
| SMILES | O=C(O)Cn1cc(-c2ccccc2Cc2cccc(C(F)(F)F)c2)cn1.OCCn1cc(-c2ccccc2Cc2cccc(C(F)(F)F)c2)cn1.[B]C |
| InChI | InChI=1S/C19H15F3N2O2.C19H17F3N2O.CH3B/c20-19(21,22)16-6-3-4-13(9-16)8-14-5-1-2-7-17(14)15-10-23-24(11-15)12-18(25)26;20-19(21,22)17-6-3-4-14(11-17)10-15-5-1-2-7-18(15)16-12-23-24(13-16)8-9-25;1-2/h1-7,9-11H,8,12H2,(H,25,26);1-7,11-13,25H,8-10H2;1H3 |
| InChIKey | ZFIJFLJUXKGYEV-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.53 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|