C23H17F4N3O2 — CID 157098174
3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid (PubChem CID 157098174) has the molecular formula C23H17F4N3O2 and a molecular weight of 443.40 g/mol. Its IUPAC name is 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 157098174 |
| Molecular Formula | C23H17F4N3O2 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid |
| SMILES | CNCc1cccc(-c2c(F)c(F)c(-c3cc(C(=O)O)c4c(c3)ncn4C)c(F)c2F)c1 |
| InChI | InChI=1S/C23H17F4N3O2/c1-28-9-11-4-3-5-12(6-11)16-18(24)20(26)17(21(27)19(16)25)13-7-14(23(31)32)22-15(8-13)29-10-30(22)2/h3-8,10,28H,9H2,1-2H3,(H,31,32) |
| InChIKey | ZTXNCHFPGMVXSV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|