C27H24F4N4O2 — CID 157098176
3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzimidazole-4-carboxylic acid (PubChem CID 157098176) has the molecular formula C27H24F4N4O2 and a molecular weight of 512.51 g/mol. Its IUPAC name is 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzimidazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 157098176 |
| Molecular Formula | C27H24F4N4O2 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzimidazole-4-carboxylic acid |
| SMILES | CN1CCN(Cc2cccc(-c3c(F)c(F)c(-c4cc(C(=O)O)c5c(c4)ncn5C)c(F)c3F)c2)CC1 |
| InChI | InChI=1S/C27H24F4N4O2/c1-33-6-8-35(9-7-33)13-15-4-3-5-16(10-15)20-22(28)24(30)21(25(31)23(20)29)17-11-18(27(36)37)26-19(12-17)32-14-34(26)2/h3-5,10-12,14H,6-9,13H2,1-2H3,(H,36,37) |
| InChIKey | MVRSIPBOOVHNKI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|