C31H39F3O8S — CID 157098222
methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-hydroxybenzoate;methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 157098222) has the molecular formula C31H39F3O8S and a molecular weight of 628.71 g/mol. Its IUPAC name is methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-hydroxybenzoate;methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-hydroxybenzoate;methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 157098222 |
| Molecular Formula | C31H39F3O8S |
| Molecular Weight | 628.71 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-hydroxybenzoate;methyl 3-[(1R)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1ccc(O)c([C@@H]2CCCC2(C)C)c1.COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c([C@@H]2CCCC2(C)C)c1 |
| InChI | InChI=1S/C16H19F3O5S.C15H20O3/c1-15(2)8-4-5-12(15)11-9-10(14(20)23-3)6-7-13(11)24-25(21,22)16(17,18)19;1-15(2)8-4-5-12(15)11-9-10(14(17)18-3)6-7-13(11)16/h6-7,9,12H,4-5,8H2,1-3H3;6-7,9,12,16H,4-5,8H2,1-3H3/t2*12-/m00/s1 |
| InChIKey | AFLNIVLMZBBFEQ-ILSZIBLNSA-N |
| XLogP | 7.47 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|