About lithium;pyrrolidine-2,5-dione;trifluoromethane
lithium;pyrrolidine-2,5-dione;trifluoromethane (PubChem CID 157099181) has the molecular formula C5H5F3LiNO2
and a molecular weight of 175.03 g/mol. Its IUPAC name is lithium;pyrrolidine-2,5-dione;trifluoromethane.
Molecular Properties
| Compound Name | lithium;pyrrolidine-2,5-dione;trifluoromethane |
| PubChem CID | 157099181 |
| Molecular Formula | C5H5F3LiNO2 |
| Molecular Weight | 175.03 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | lithium;pyrrolidine-2,5-dione;trifluoromethane |
| SMILES | F[C-](F)F.O=C1CCC(=O)N1.[Li+] |
| InChI | InChI=1S/C4H5NO2.CF3.Li/c6-3-1-2-4(7)5-3;2-1(3)4;/h1-2H2,(H,5,6,7);;/q;-1;+1 |
| InChIKey | WHCWPDJLCVRUFQ-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.03 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze lithium;pyrrolidine-2,5-dione;trifluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;pyrrolidine-2,5-dione;trifluoromethane?
The IUPAC name of lithium;pyrrolidine-2,5-dione;trifluoromethane (CID 157099181) is lithium;pyrrolidine-2,5-dione;trifluoromethane.
What is the SMILES notation for lithium;pyrrolidine-2,5-dione;trifluoromethane?
The canonical SMILES for lithium;pyrrolidine-2,5-dione;trifluoromethane is F[C-](F)F.O=C1CCC(=O)N1.[Li+].
What is the InChIKey of lithium;pyrrolidine-2,5-dione;trifluoromethane?
The InChIKey is WHCWPDJLCVRUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.CF3.Li/c6-3-1-2-4(7)5-3;2-1(3)4;/h1-2H2,(H,5,6,7);;/q;-1;+1.
What are the key properties of lithium;pyrrolidine-2,5-dione;trifluoromethane?
lithium;pyrrolidine-2,5-dione;trifluoromethane has a molecular weight of 175.03 g/mol, XLogP of -2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;pyrrolidine-2,5-dione;trifluoromethane is sourced from PubChem (CID 157099181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).