C19H31FN6O6 — CID 157099280
(2S)-2-[[(1R)-5-[3-[1-(2-(18F)fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoylamino]pentanoic acid (PubChem CID 157099280) has the molecular formula C19H31FN6O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is (2S)-2-[[(1R)-5-[3-[1-(2-(18F)fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoylamino]pentanoic acid.
| Compound Name | (2S)-2-[[(1R)-5-[3-[1-(2-(18F)fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 157099280 |
| Molecular Formula | C19H31FN6O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (2S)-2-[[(1R)-5-[3-[1-(2-(18F)fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoylamino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)N[C@@H](CCCCNC(=O)CCc1cn(CC[18F])nn1)OC=O)C(=O)O |
| InChI | InChI=1S/C19H31FN6O6/c1-2-5-15(18(29)30)22-19(31)23-17(32-13-27)6-3-4-10-21-16(28)8-7-14-12-26(11-9-20)25-24-14/h12-13,15,17H,2-11H2,1H3,(H,21,28)(H,29,30)(H2,22,23,31)/t15-,17+/m0/s1/i20-1 |
| InChIKey | AFOQBONFTVQUMQ-JLPPWWIISA-N |
| XLogP | 0.52 |
| TPSA | 164.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|