C23H31IN2O — CID 157100368
(1S)-1-[4-[(5-cyclobutyloxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethanamine;iodomethane (PubChem CID 157100368) has the molecular formula C23H31IN2O and a molecular weight of 478.42 g/mol. Its IUPAC name is (1S)-1-[4-[(5-cyclobutyloxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethanamine;iodomethane.
| Compound Name | (1S)-1-[4-[(5-cyclobutyloxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethanamine;iodomethane |
|---|---|
| PubChem CID | 157100368 |
| Molecular Formula | C23H31IN2O |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (1S)-1-[4-[(5-cyclobutyloxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethanamine;iodomethane |
| SMILES | CI.C[C@H](N)c1ccc(CN2CCc3c(cccc3OC3CCC3)C2)cc1 |
| InChI | InChI=1S/C22H28N2O.CH3I/c1-16(23)18-10-8-17(9-11-18)14-24-13-12-21-19(15-24)4-2-7-22(21)25-20-5-3-6-20;1-2/h2,4,7-11,16,20H,3,5-6,12-15,23H2,1H3;1H3/t16-;/m0./s1 |
| InChIKey | AFRSRIREYAZMSH-NTISSMGPSA-N |
| XLogP | 5.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|