C31H26BrN9O6S2 — CID 157101176
4-[(6-bromo-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide;4-[(6-cyano-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide (PubChem CID 157101176) has the molecular formula C31H26BrN9O6S2 and a molecular weight of 764.64 g/mol. Its IUPAC name is 4-[(6-bromo-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide;4-[(6-cyano-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(6-bromo-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide;4-[(6-cyano-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 157101176 |
| Molecular Formula | C31H26BrN9O6S2 |
| Molecular Weight | 764.64 g/mol |
| Exact Mass | 763.06 |
| IUPAC Name | 4-[(6-bromo-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide;4-[(6-cyano-8-methoxyquinazolin-2-yl)amino]benzenesulfonamide |
| SMILES | COc1cc(Br)cc2cnc(Nc3ccc(S(N)(=O)=O)cc3)nc12.COc1cc(C#N)cc2cnc(Nc3ccc(S(N)(=O)=O)cc3)nc12 |
| InChI | InChI=1S/C16H13N5O3S.C15H13BrN4O3S/c1-24-14-7-10(8-17)6-11-9-19-16(21-15(11)14)20-12-2-4-13(5-3-12)25(18,22)23;1-23-13-7-10(16)6-9-8-18-15(20-14(9)13)19-11-2-4-12(5-3-11)24(17,21)22/h2-7,9H,1H3,(H2,18,22,23)(H,19,20,21);2-8H,1H3,(H2,17,21,22)(H,18,19,20) |
| InChIKey | AFTWYTMBEUIWFH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 238.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |