C28H35N2O5S+ — CID 157104431
5-(3,3-dimethylbut-1-ynyl)-3-[[3-(1-hydroxypyridin-1-ium-3-yl)oxycyclobutyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 157104431) has the molecular formula C28H35N2O5S+ and a molecular weight of 511.66 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[[3-(1-hydroxypyridin-1-ium-3-yl)oxycyclobutyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[3-(1-hydroxypyridin-1-ium-3-yl)oxycyclobutyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 157104431 |
| Molecular Formula | C28H35N2O5S+ |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[3-(1-hydroxypyridin-1-ium-3-yl)oxycyclobutyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | CC1CCC(C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)C2CC(Oc3ccc[n+](O)c3)C2)CC1 |
| InChI | InChI=1S/C28H34N2O5S/c1-18-7-9-19(10-8-18)26(31)30(20-14-22(15-20)35-21-6-5-13-29(34)17-21)24-16-23(11-12-28(2,3)4)36-25(24)27(32)33/h5-6,13,16-20,22H,7-10,14-15H2,1-4H3,(H-,32,33,34)/p+1 |
| InChIKey | AGDGPIQIXZZHEY-UHFFFAOYSA-O |
| XLogP | 5.14 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|