About 1,1,1-trichloropropane
1,1,1-trichloropropane (PubChem CID 157104556) has the molecular formula C6H10Cl6
and a molecular weight of 294.86 g/mol. Its IUPAC name is 1,1,1-trichloropropane.
Molecular Properties
| Compound Name | 1,1,1-trichloropropane |
| PubChem CID | 157104556 |
| Molecular Formula | C6H10Cl6 |
| Molecular Weight | 294.86 g/mol |
| Exact Mass | 291.89 |
| IUPAC Name | 1,1,1-trichloropropane |
| SMILES | CCC(Cl)(Cl)Cl.CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/2C3H5Cl3/c2*1-2-3(4,5)6/h2*2H2,1H3 |
| InChIKey | AGDOYTQSSCTFPT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.86 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1-trichloropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trichloropropane?
The IUPAC name of 1,1,1-trichloropropane (CID 157104556) is 1,1,1-trichloropropane.
What is the SMILES notation for 1,1,1-trichloropropane?
The canonical SMILES for 1,1,1-trichloropropane is CCC(Cl)(Cl)Cl.CCC(Cl)(Cl)Cl.
What is the InChIKey of 1,1,1-trichloropropane?
The InChIKey is AGDOYTQSSCTFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H5Cl3/c2*1-2-3(4,5)6/h2*2H2,1H3.
What are the key properties of 1,1,1-trichloropropane?
1,1,1-trichloropropane has a molecular weight of 294.86 g/mol, XLogP of 5.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trichloropropane is sourced from PubChem (CID 157104556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).