About 2-phenyl-1H-imidazol-5-amine;ruthenium
2-phenyl-1H-imidazol-5-amine;ruthenium (PubChem CID 157104947) has the molecular formula C9H9N3Ru
and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-phenyl-1H-imidazol-5-amine;ruthenium.
Molecular Properties
| Compound Name | 2-phenyl-1H-imidazol-5-amine;ruthenium |
| PubChem CID | 157104947 |
| Molecular Formula | C9H9N3Ru |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 2-phenyl-1H-imidazol-5-amine;ruthenium |
| SMILES | Nc1cnc(-c2ccccc2)[nH]1.[Ru] |
| InChI | InChI=1S/C9H9N3.Ru/c10-8-6-11-9(12-8)7-4-2-1-3-5-7;/h1-6H,10H2,(H,11,12); |
| InChIKey | AGEQRSJENMRVHU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-1H-imidazol-5-amine;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1H-imidazol-5-amine;ruthenium?
The IUPAC name of 2-phenyl-1H-imidazol-5-amine;ruthenium (CID 157104947) is 2-phenyl-1H-imidazol-5-amine;ruthenium.
What is the SMILES notation for 2-phenyl-1H-imidazol-5-amine;ruthenium?
The canonical SMILES for 2-phenyl-1H-imidazol-5-amine;ruthenium is Nc1cnc(-c2ccccc2)[nH]1.[Ru].
What is the InChIKey of 2-phenyl-1H-imidazol-5-amine;ruthenium?
The InChIKey is AGEQRSJENMRVHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.Ru/c10-8-6-11-9(12-8)7-4-2-1-3-5-7;/h1-6H,10H2,(H,11,12);.
What are the key properties of 2-phenyl-1H-imidazol-5-amine;ruthenium?
2-phenyl-1H-imidazol-5-amine;ruthenium has a molecular weight of 260.26 g/mol, XLogP of 1.66, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1H-imidazol-5-amine;ruthenium is sourced from PubChem (CID 157104947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).