About 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one
2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one (PubChem CID 157105506) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one |
| PubChem CID | 157105506 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)C.CC(C)Cc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O.C4H10/c1-6(2)5-7-9-4-3-8(11)10-7;1-4(2)3/h3-4,6H,5H2,1-2H3,(H,9,10,11);4H,1-3H3 |
| InChIKey | AGGFLAIGNRWNHU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one?
The IUPAC name of 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one (CID 157105506) is 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one is CC(C)C.CC(C)Cc1nccc(=O)[nH]1.
What is the InChIKey of 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one?
The InChIKey is AGGFLAIGNRWNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O.C4H10/c1-6(2)5-7-9-4-3-8(11)10-7;1-4(2)3/h3-4,6H,5H2,1-2H3,(H,9,10,11);4H,1-3H3.
What are the key properties of 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one?
2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one has a molecular weight of 210.32 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;2-(2-methylpropyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 157105506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).