About 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one
2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one (PubChem CID 15710672) has the molecular formula C20H15NO4S
and a molecular weight of 365.41 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one.
Molecular Properties
| Compound Name | 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one |
| PubChem CID | 15710672 |
| Molecular Formula | C20H15NO4S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one |
| SMILES | CCOc1ccc(-c2nc(-c3oc4ccccc4c(=O)c3O)cs2)cc1 |
| InChI | InChI=1S/C20H15NO4S/c1-2-24-13-9-7-12(8-10-13)20-21-15(11-26-20)19-18(23)17(22)14-5-3-4-6-16(14)25-19/h3-11,23H,2H2,1H3 |
| InChIKey | NRQAANDGLYYNRB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one?
The IUPAC name of 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one (CID 15710672) is 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one.
What is the SMILES notation for 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one?
The canonical SMILES for 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one is CCOc1ccc(-c2nc(-c3oc4ccccc4c(=O)c3O)cs2)cc1.
What is the InChIKey of 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one?
The InChIKey is NRQAANDGLYYNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO4S/c1-2-24-13-9-7-12(8-10-13)20-21-15(11-26-20)19-18(23)17(22)14-5-3-4-6-16(14)25-19/h3-11,23H,2H2,1H3.
What are the key properties of 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one?
2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one has a molecular weight of 365.41 g/mol, XLogP of 4.69, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-3-hydroxychromen-4-one is sourced from PubChem (CID 15710672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).