C22H28N2O3 — CID 157106921
(4aR,8aS)-6-[3-(4-cyclobutylphenyl)azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 157106921) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-(4-cyclobutylphenyl)azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-(4-cyclobutylphenyl)azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 157106921 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (4aR,8aS)-6-[3-(4-cyclobutylphenyl)azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC(c4ccc(C5CCC5)cc4)C3)C[C@H]2C1 |
| InChI | InChI=1S/C22H28N2O3/c25-20-10-18-11-23(9-8-21(18)27-14-20)22(26)24-12-19(13-24)17-6-4-16(5-7-17)15-2-1-3-15/h4-7,15,18-19,21H,1-3,8-14H2/t18-,21+/m1/s1 |
| InChIKey | AGKCWTYKRDCJIB-NQIIRXRSSA-N |
| XLogP | 3.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |