About 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine
4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 15710714) has the molecular formula C5H2F6N2S
and a molecular weight of 236.14 g/mol. Its IUPAC name is 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine |
| PubChem CID | 15710714 |
| Molecular Formula | C5H2F6N2S |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C(F)(F)F)c(C(F)(F)F)s1 |
| InChI | InChI=1S/C5H2F6N2S/c6-4(7,8)1-2(5(9,10)11)14-3(12)13-1/h(H2,12,13) |
| InChIKey | GXNOWIIFOVMSNQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine?
The IUPAC name of 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine (CID 15710714) is 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine is Nc1nc(C(F)(F)F)c(C(F)(F)F)s1.
What is the InChIKey of 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine?
The InChIKey is GXNOWIIFOVMSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F6N2S/c6-4(7,8)1-2(5(9,10)11)14-3(12)13-1/h(H2,12,13).
What are the key properties of 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine?
4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine has a molecular weight of 236.14 g/mol, XLogP of 2.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(trifluoromethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 15710714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).