C32H23BrN4O2 — CID 157107460
3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)indole (PubChem CID 157107460) has the molecular formula C32H23BrN4O2 and a molecular weight of 575.47 g/mol. Its IUPAC name is 3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)indole.
| Compound Name | 3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)indole |
|---|---|
| PubChem CID | 157107460 |
| Molecular Formula | C32H23BrN4O2 |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)indole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(Br)cn2-c1ccc(OC)cc1.[C-]#[N+]c1ccc2c(ccn2-c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C16H11BrN2O.C16H12N2O/c1-18-11-3-8-16-14(9-11)15(17)10-19(16)12-4-6-13(20-2)7-5-12;1-17-13-3-8-16-12(11-13)9-10-18(16)14-4-6-15(19-2)7-5-14/h3-10H,2H3;3-11H,2H3 |
| InChIKey | AGLQMTVWSBTLTN-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 37.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|