C16H21ClN4O4 — CID 157107561
(E)-but-2-enedioic acid;3-(6-chloropyridazin-3-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane (PubChem CID 157107561) has the molecular formula C16H21ClN4O4 and a molecular weight of 368.82 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(6-chloropyridazin-3-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane.
| Compound Name | (E)-but-2-enedioic acid;3-(6-chloropyridazin-3-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 157107561 |
| Molecular Formula | C16H21ClN4O4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(6-chloropyridazin-3-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane |
| SMILES | CN1C2CCCC1CN(c1ccc(Cl)nn1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H17ClN4.C4H4O4/c1-16-9-3-2-4-10(16)8-17(7-9)12-6-5-11(13)14-15-12;5-3(6)1-2-4(7)8/h5-6,9-10H,2-4,7-8H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | AGLXLHFBAXNIDR-WLHGVMLRSA-N |
| XLogP | 1.51 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|