About oxalic acid;1-propylpiperidine
oxalic acid;1-propylpiperidine (PubChem CID 157108548) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is oxalic acid;1-propylpiperidine.
Molecular Properties
| Compound Name | oxalic acid;1-propylpiperidine |
| PubChem CID | 157108548 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | oxalic acid;1-propylpiperidine |
| SMILES | CCCN1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H17N.C2H2O4/c1-2-6-9-7-4-3-5-8-9;3-1(4)2(5)6/h2-8H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | AGOSURBTSVITQJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;1-propylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;1-propylpiperidine?
The IUPAC name of oxalic acid;1-propylpiperidine (CID 157108548) is oxalic acid;1-propylpiperidine.
What is the SMILES notation for oxalic acid;1-propylpiperidine?
The canonical SMILES for oxalic acid;1-propylpiperidine is CCCN1CCCCC1.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;1-propylpiperidine?
The InChIKey is AGOSURBTSVITQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2H2O4/c1-2-6-9-7-4-3-5-8-9;3-1(4)2(5)6/h2-8H2,1H3;(H,3,4)(H,5,6).
What are the key properties of oxalic acid;1-propylpiperidine?
oxalic acid;1-propylpiperidine has a molecular weight of 217.26 g/mol, XLogP of 1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;1-propylpiperidine is sourced from PubChem (CID 157108548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).