C29H37FO5Si — CID 15711000
[5-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 15711000) has the molecular formula C29H37FO5Si and a molecular weight of 512.69 g/mol. Its IUPAC name is [5-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [5-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15711000 |
| Molecular Formula | C29H37FO5Si |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [5-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC1C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC2OC(=O)C(F)C21 |
| InChI | InChI=1S/C29H37FO5Si/c1-28(2,3)27(32)33-18-21-22(17-23-24(21)25(30)26(31)34-23)35-36(29(4,5)6,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-25H,17-18H2,1-6H3 |
| InChIKey | VGTUHZQHGRRCFI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|