C14H7F6NO — CID 15711006
N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)naphthalene-2-carboxamide (PubChem CID 15711006) has the molecular formula C14H7F6NO and a molecular weight of 319.20 g/mol. Its IUPAC name is N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)naphthalene-2-carboxamide.
| Compound Name | N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 15711006 |
| Molecular Formula | C14H7F6NO |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)naphthalene-2-carboxamide |
| SMILES | O=C(N=C(C(F)(F)F)C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H7F6NO/c15-13(16,17)12(14(18,19)20)21-11(22)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | DZVOZNAAINSTNM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|