C23H15F7O2 — CID 157110326
1-[3-(2-oxopropyl)naphthalen-1-yl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 157110326) has the molecular formula C23H15F7O2 and a molecular weight of 456.36 g/mol. Its IUPAC name is 1-[3-(2-oxopropyl)naphthalen-1-yl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-[3-(2-oxopropyl)naphthalen-1-yl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 157110326 |
| Molecular Formula | C23H15F7O2 |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-[3-(2-oxopropyl)naphthalen-1-yl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | CC(=O)Cc1cc(CC(=O)Cc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c2ccccc2c1 |
| InChI | InChI=1S/C23H15F7O2/c1-11(31)6-12-7-13-4-2-3-5-16(13)14(8-12)9-15(32)10-17-19(24)21(26)18(23(28,29)30)22(27)20(17)25/h2-5,7-8H,6,9-10H2,1H3 |
| InChIKey | AGTSXJSFKYZGIY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|