C29H27F3N4O2 — CID 157110329
8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one (PubChem CID 157110329) has the molecular formula C29H27F3N4O2 and a molecular weight of 520.56 g/mol. Its IUPAC name is 8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one.
| Compound Name | 8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 157110329 |
| Molecular Formula | C29H27F3N4O2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
| SMILES | CCn1c(=O)c2c(-c3ccc(O)c(C(F)(F)F)c3)nc3[nH]cc(C)c3c2c2ccc(N3CCCCC3)cc21 |
| InChI | InChI=1S/C29H27F3N4O2/c1-3-36-21-14-18(35-11-5-4-6-12-35)8-9-19(21)24-23-16(2)15-33-27(23)34-26(25(24)28(36)38)17-7-10-22(37)20(13-17)29(30,31)32/h7-10,13-15,37H,3-6,11-12H2,1-2H3,(H,33,34) |
| InChIKey | NQRPLNVAADQPIY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|