About CID 157112402
CID 157112402 (PubChem CID 157112402) has the molecular formula C55H65N9O14S2
and a molecular weight of 1140.31 g/mol.
Molecular Properties
| Compound Name | CID 157112402 |
| PubChem CID | 157112402 |
| Molecular Formula | C55H65N9O14S2 |
| Molecular Weight | 1140.31 g/mol |
| Exact Mass | 1139.41 |
| IUPAC Name | — |
| SMILES | CCSC1SCC2C(=O)N(C)C3(CC3C)C(=O)OCC(CC(=O)c3nc4ccccc4cc3O)C(=O)NC(C)C(=O)N(C)C1C(=O)N(C)C1(CC1C)C(=O)OCC(NC(=O)c1nc3ccccc3cc1O)C(=O)NC(C)C(=O)N2C |
| InChI | InChI=1S/C55H65N9O14S2/c1-10-79-51-43-50(74)64(9)55(23-28(55)3)53(76)78-25-36(60-46(70)42-40(67)20-32-16-12-14-18-35(32)59-42)45(69)57-29(4)47(71)61(6)37(26-80-51)49(73)63(8)54(22-27(54)2)52(75)77-24-33(44(68)56-30(5)48(72)62(43)7)21-39(66)41-38(65)19-31-15-11-13-17-34(31)58-41/h11-20,27-30,33,36-37,43,51,65,67H,10,21-26H2,1-9H3,(H,56,68)(H,57,69)(H,60,70) |
| InChIKey | AGZUZTGZWUNJNE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 304.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1140.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
Analyze CID 157112402 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157112402?
The IUPAC name of CID 157112402 (CID 157112402) is not available.
What is the SMILES notation for CID 157112402?
The canonical SMILES for CID 157112402 is CCSC1SCC2C(=O)N(C)C3(CC3C)C(=O)OCC(CC(=O)c3nc4ccccc4cc3O)C(=O)NC(C)C(=O)N(C)C1C(=O)N(C)C1(CC1C)C(=O)OCC(NC(=O)c1nc3ccccc3cc1O)C(=O)NC(C)C(=O)N2C.
What is the InChIKey of CID 157112402?
The InChIKey is AGZUZTGZWUNJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C55H65N9O14S2/c1-10-79-51-43-50(74)64(9)55(23-28(55)3)53(76)78-25-36(60-46(70)42-40(67)20-32-16-12-14-18-35(32)59-42)45(69)57-29(4)47(71)61(6)37(26-80-51)49(73)63(8)54(22-27(54)2)52(75)77-24-33(44(68)56-30(5)48(72)62(43)7)21-39(66)41-38(65)19-31-15-11-13-17-34(31)58-41/h11-20,27-30,33,36-37,43,51,65,67H,10,21-26H2,1-9H3,(H,56,68)(H,57,69)(H,60,70).
What are the key properties of CID 157112402?
CID 157112402 has a molecular weight of 1140.31 g/mol, XLogP of 2.25, 7 rotatable bonds, 5 hydrogen bond donors, and 18 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157112402 is sourced from PubChem (CID 157112402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).