4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether

C15H13NOS — CID 15711316

IUPAC2-[(4-methoxyphenyl)methyl]-1,3-benzothiazole
SMILESCOC1=CC=C(C=C1)CC2=NC3=CC=CC=C3S2
InChIInChI=1S/C15H13NOS/c1-17-12-8-6-11(7-9-12)10-15-16-13-4-2-3-5-14(13)18-15/h2-9H,10H2,1H3
InChIKeyCCWGMEMHIWZDTQ-UHFFFAOYSA-N
MW255.30 g/mol
LogP4.30
Rot. Bonds3

About 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether

4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether (PubChem CID 15711316) has the molecular formula C15H13NOS and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-1,3-benzothiazole.

Molecular Properties

Compound Name4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether
PubChem CID15711316
Molecular FormulaC15H13NOS
Molecular Weight255.30 g/mol
Exact Mass255.07
IUPAC Name2-[(4-methoxyphenyl)methyl]-1,3-benzothiazole
SMILESCOC1=CC=C(C=C1)CC2=NC3=CC=CC=C3S2
InChIInChI=1S/C15H13NOS/c1-17-12-8-6-11(7-9-12)10-15-16-13-4-2-3-5-14(13)18-15/h2-9H,10H2,1H3
InChIKeyCCWGMEMHIWZDTQ-UHFFFAOYSA-N
XLogP4.30
TPSA50.40 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity265

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.30
LogP ≤ 54.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
The IUPAC name of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether (CID 15711316) is 2-[(4-methoxyphenyl)methyl]-1,3-benzothiazole.
What is the SMILES notation for 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
The canonical SMILES for 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether is COC1=CC=C(C=C1)CC2=NC3=CC=CC=C3S2.
What is the InChIKey of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
The InChIKey is CCWGMEMHIWZDTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NOS/c1-17-12-8-6-11(7-9-12)10-15-16-13-4-2-3-5-14(13)18-15/h2-9H,10H2,1H3.
What are the key properties of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether has a molecular weight of 255.30 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether is sourced from PubChem (CID 15711316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).