About 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether
4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether (PubChem CID 15711316) has the molecular formula C15H13NOS
and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether |
| PubChem CID | 15711316 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-1,3-benzothiazole |
| SMILES | COC1=CC=C(C=C1)CC2=NC3=CC=CC=C3S2 |
| InChI | InChI=1S/C15H13NOS/c1-17-12-8-6-11(7-9-12)10-15-16-13-4-2-3-5-14(13)18-15/h2-9H,10H2,1H3 |
| InChIKey | CCWGMEMHIWZDTQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 265 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
The IUPAC name of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether (CID 15711316) is 2-[(4-methoxyphenyl)methyl]-1,3-benzothiazole.
What is the SMILES notation for 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
The canonical SMILES for 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether is COC1=CC=C(C=C1)CC2=NC3=CC=CC=C3S2.
What is the InChIKey of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
The InChIKey is CCWGMEMHIWZDTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NOS/c1-17-12-8-6-11(7-9-12)10-15-16-13-4-2-3-5-14(13)18-15/h2-9H,10H2,1H3.
What are the key properties of 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether?
4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether has a molecular weight of 255.30 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-Benzothiazol-2-ylmethyl)phenyl methyl ether is sourced from PubChem (CID 15711316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).