About CID 157113916
CID 157113916 (PubChem CID 157113916) has the molecular formula C55H67B9N12
and a molecular weight of 993.53 g/mol.
Molecular Properties
| Compound Name | CID 157113916 |
| PubChem CID | 157113916 |
| Molecular Formula | C55H67B9N12 |
| Molecular Weight | 993.53 g/mol |
| Exact Mass | 994.64 |
| IUPAC Name | — |
| SMILES | C.CC.CC.CC.CC.CC.CC.[B][B][B]c1c(C)c2ccnnc2n2c1nc1ccccc12.[B][B][B]c1c(C)c2cncnc2n2c1nc1ccccc12.[B][B][B]c1c(C)c2nccnc2n2c1nc1ccccc12 |
| InChI | InChI=1S/3C14H9B3N4.6C2H6.CH4/c1-8-9-6-18-7-19-13(9)21-11-5-3-2-4-10(11)20-14(21)12(8)16-17-15;1-8-9-6-7-18-20-13(9)21-11-5-3-2-4-10(11)19-14(21)12(8)16-17-15;1-8-11(16-17-15)13-20-9-4-2-3-5-10(9)21(13)14-12(8)18-6-7-19-14;6*1-2;/h3*2-7H,1H3;6*1-2H3;1H4 |
| InChIKey | OACMNKSQFANTEB-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 129.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 993.53 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157113916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157113916?
The IUPAC name of CID 157113916 (CID 157113916) is not available.
What is the SMILES notation for CID 157113916?
The canonical SMILES for CID 157113916 is C.CC.CC.CC.CC.CC.CC.[B][B][B]c1c(C)c2ccnnc2n2c1nc1ccccc12.[B][B][B]c1c(C)c2cncnc2n2c1nc1ccccc12.[B][B][B]c1c(C)c2nccnc2n2c1nc1ccccc12.
What is the InChIKey of CID 157113916?
The InChIKey is OACMNKSQFANTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/3C14H9B3N4.6C2H6.CH4/c1-8-9-6-18-7-19-13(9)21-11-5-3-2-4-10(11)20-14(21)12(8)16-17-15;1-8-9-6-7-18-20-13(9)21-11-5-3-2-4-10(11)19-14(21)12(8)16-17-15;1-8-11(16-17-15)13-20-9-4-2-3-5-10(9)21(13)14-12(8)18-6-7-19-14;6*1-2;/h3*2-7H,1H3;6*1-2H3;1H4.
What are the key properties of CID 157113916?
CID 157113916 has a molecular weight of 993.53 g/mol, XLogP of 9.11, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157113916 is sourced from PubChem (CID 157113916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).