C11H17F7S — CID 15711440
1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)octane (PubChem CID 15711440) has the molecular formula C11H17F7S and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)octane.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)octane |
|---|---|
| PubChem CID | 15711440 |
| Molecular Formula | C11H17F7S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)octane |
| SMILES | CCCCCCCCSC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H17F7S/c1-2-3-4-5-6-7-8-19-11(17,18)9(12,13)10(14,15)16/h2-8H2,1H3 |
| InChIKey | RIEUJOPBQXMGAK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|