C9H3F11OS — CID 15711447
2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]thiophene (PubChem CID 15711447) has the molecular formula C9H3F11OS and a molecular weight of 368.17 g/mol. Its IUPAC name is 2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]thiophene.
| Compound Name | 2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]thiophene |
|---|---|
| PubChem CID | 15711447 |
| Molecular Formula | C9H3F11OS |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]thiophene |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C9H3F11OS/c10-5(7(13,14)15,4-2-1-3-22-4)21-9(19,20)6(11,12)8(16,17)18/h1-3H |
| InChIKey | BUFYVOVLWBMMBV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|