C12H3F17O2S — CID 15711448
2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]thiophene (PubChem CID 15711448) has the molecular formula C12H3F17O2S and a molecular weight of 534.19 g/mol. Its IUPAC name is 2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]thiophene.
| Compound Name | 2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]thiophene |
|---|---|
| PubChem CID | 15711448 |
| Molecular Formula | C12H3F17O2S |
| Molecular Weight | 534.19 g/mol |
| Exact Mass | 533.96 |
| IUPAC Name | 2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]thiophene |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C12H3F17O2S/c13-5(8(17,18)19,4-2-1-3-32-4)30-12(28,29)7(16,10(23,24)25)31-11(26,27)6(14,15)9(20,21)22/h1-3H |
| InChIKey | YMFWNOGGQDOOQA-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.19 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|