C27H29N3O10 — CID 157114937
dimethyl pyridine-2,5-dicarboxylate;ethyl 6-formylpyridine-3-carboxylate;ethyl 6-(hydroxymethyl)pyridine-3-carboxylate (PubChem CID 157114937) has the molecular formula C27H29N3O10 and a molecular weight of 555.54 g/mol. Its IUPAC name is dimethyl pyridine-2,5-dicarboxylate;ethyl 6-formylpyridine-3-carboxylate;ethyl 6-(hydroxymethyl)pyridine-3-carboxylate.
| Compound Name | dimethyl pyridine-2,5-dicarboxylate;ethyl 6-formylpyridine-3-carboxylate;ethyl 6-(hydroxymethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 157114937 |
| Molecular Formula | C27H29N3O10 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | dimethyl pyridine-2,5-dicarboxylate;ethyl 6-formylpyridine-3-carboxylate;ethyl 6-(hydroxymethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C=O)nc1.CCOC(=O)c1ccc(CO)nc1.COC(=O)c1ccc(C(=O)OC)nc1 |
| InChI | InChI=1S/C9H9NO4.C9H11NO3.C9H9NO3/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2;2*1-2-13-9(12)7-3-4-8(6-11)10-5-7/h3-5H,1-2H3;3-5,11H,2,6H2,1H3;3-6H,2H2,1H3 |
| InChIKey | AHHAWNFADGXZDA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 181.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|