C12H10F2O4 — CID 157115932
3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol (PubChem CID 157115932) has the molecular formula C12H10F2O4 and a molecular weight of 256.20 g/mol. Its IUPAC name is 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol.
| Compound Name | 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 157115932 |
| Molecular Formula | C12H10F2O4 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol |
| SMILES | Oc1ccc(F)cc1O.Oc1cccc(F)c1O |
| InChI | InChI=1S/2C6H5FO2/c7-4-1-2-5(8)6(9)3-4;7-4-2-1-3-5(8)6(4)9/h2*1-3,8-9H |
| InChIKey | AHKCXNOFDFUGKG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|