About 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol
3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol (PubChem CID 157115932) has the molecular formula C12H10F2O4
and a molecular weight of 256.20 g/mol. Its IUPAC name is 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol.
Molecular Properties
| Compound Name | 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol |
| PubChem CID | 157115932 |
| Molecular Formula | C12H10F2O4 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol |
| SMILES | Oc1ccc(F)cc1O.Oc1cccc(F)c1O |
| InChI | InChI=1S/2C6H5FO2/c7-4-1-2-5(8)6(9)3-4;7-4-2-1-3-5(8)6(4)9/h2*1-3,8-9H |
| InChIKey | AHKCXNOFDFUGKG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol?
The IUPAC name of 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol (CID 157115932) is 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol.
What is the SMILES notation for 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol?
The canonical SMILES for 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol is Oc1ccc(F)cc1O.Oc1cccc(F)c1O.
What is the InChIKey of 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol?
The InChIKey is AHKCXNOFDFUGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5FO2/c7-4-1-2-5(8)6(9)3-4;7-4-2-1-3-5(8)6(4)9/h2*1-3,8-9H.
What are the key properties of 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol?
3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol has a molecular weight of 256.20 g/mol, XLogP of 2.47, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorobenzene-1,2-diol;4-fluorobenzene-1,2-diol is sourced from PubChem (CID 157115932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).