C22H22Cl3NO6 — CID 157116153
(3R)-N,N-bis(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride (PubChem CID 157116153) has the molecular formula C22H22Cl3NO6 and a molecular weight of 502.78 g/mol. Its IUPAC name is (3R)-N,N-bis(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride.
| Compound Name | (3R)-N,N-bis(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride |
|---|---|
| PubChem CID | 157116153 |
| Molecular Formula | C22H22Cl3NO6 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | (3R)-N,N-bis(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride |
| SMILES | O=C(Cl)[C@H]1COc2ccccc2O1.O=C([C@H]1COc2ccccc2O1)N(CCCl)CCCl |
| InChI | InChI=1S/C13H15Cl2NO3.C9H7ClO3/c14-5-7-16(8-6-15)13(17)12-9-18-10-3-1-2-4-11(10)19-12;10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,12H,5-9H2;1-4,8H,5H2/t12-;8-/m11/s1 |
| InChIKey | AHKUSHYXRSNFRJ-VTSZJYDFSA-N |
| XLogP | 3.72 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|