C13H30N2S2 — CID 157116674
(2R,5R)-2-(ethylamino)-5-(ethylaminomethyl)-2,5-dimethylhexane-1,6-dithiol (PubChem CID 157116674) has the molecular formula C13H30N2S2 and a molecular weight of 278.53 g/mol. Its IUPAC name is (2R,5R)-2-(ethylamino)-5-(ethylaminomethyl)-2,5-dimethylhexane-1,6-dithiol.
| Compound Name | (2R,5R)-2-(ethylamino)-5-(ethylaminomethyl)-2,5-dimethylhexane-1,6-dithiol |
|---|---|
| PubChem CID | 157116674 |
| Molecular Formula | C13H30N2S2 |
| Molecular Weight | 278.53 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2R,5R)-2-(ethylamino)-5-(ethylaminomethyl)-2,5-dimethylhexane-1,6-dithiol |
| SMILES | CCNC[C@](C)(CS)CC[C@](C)(CS)NCC |
| InChI | InChI=1S/C13H30N2S2/c1-5-14-9-12(3,10-16)7-8-13(4,11-17)15-6-2/h14-17H,5-11H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | BWWDNMWKDFFEBF-CHWSQXEVSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|