C30H37ClFN3O4Si — CID 157116820
3-[(2R)-2-[(1R,2S)-2-(4-chlorophenyl)-2-(3-fluorophenyl)-1-hydroxyethyl]pyrrolidine-1-carbonyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)pyridazin-4-one (PubChem CID 157116820) has the molecular formula C30H37ClFN3O4Si and a molecular weight of 586.18 g/mol. Its IUPAC name is 3-[(2R)-2-[(1R,2S)-2-(4-chlorophenyl)-2-(3-fluorophenyl)-1-hydroxyethyl]pyrrolidine-1-carbonyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)pyridazin-4-one.
| Compound Name | 3-[(2R)-2-[(1R,2S)-2-(4-chlorophenyl)-2-(3-fluorophenyl)-1-hydroxyethyl]pyrrolidine-1-carbonyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)pyridazin-4-one |
|---|---|
| PubChem CID | 157116820 |
| Molecular Formula | C30H37ClFN3O4Si |
| Molecular Weight | 586.18 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 3-[(2R)-2-[(1R,2S)-2-(4-chlorophenyl)-2-(3-fluorophenyl)-1-hydroxyethyl]pyrrolidine-1-carbonyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)pyridazin-4-one |
| SMILES | Cc1cn(COCC[Si](C)(C)C)nc(C(=O)N2CCC[C@@H]2[C@H](O)[C@@H](c2ccc(Cl)cc2)c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C30H37ClFN3O4Si/c1-20-18-34(19-39-15-16-40(2,3)4)33-27(28(20)36)30(38)35-14-6-9-25(35)29(37)26(21-10-12-23(31)13-11-21)22-7-5-8-24(32)17-22/h5,7-8,10-13,17-18,25-26,29,37H,6,9,14-16,19H2,1-4H3/t25-,26+,29+/m1/s1 |
| InChIKey | VEWUFZRPAOFJEE-ALTZYDRJSA-N |
| XLogP | 5.45 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.18 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|