C40H47O4S3+3 — CID 157118994
1-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)ethanone;2-(1,4-oxathian-4-ium-4-yl)-1-phenylethanone;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone (PubChem CID 157118994) has the molecular formula C40H47O4S3+3 and a molecular weight of 688.01 g/mol. Its IUPAC name is 1-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)ethanone;2-(1,4-oxathian-4-ium-4-yl)-1-phenylethanone;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone.
| Compound Name | 1-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)ethanone;2-(1,4-oxathian-4-ium-4-yl)-1-phenylethanone;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 157118994 |
| Molecular Formula | C40H47O4S3+3 |
| Molecular Weight | 688.01 g/mol |
| Exact Mass | 687.26 |
| IUPAC Name | 1-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)ethanone;2-(1,4-oxathian-4-ium-4-yl)-1-phenylethanone;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone |
| SMILES | O=C(C[S+]1CCCC1)c1ccc2ccccc2c1.O=C(C[S+]1CCCC1)c1ccccc1.O=C(C[S+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C16H17OS.C12H15O2S.C12H15OS/c17-16(12-18-9-3-4-10-18)15-8-7-13-5-1-2-6-14(13)11-15;13-12(11-4-2-1-3-5-11)10-15-8-6-14-7-9-15;13-12(10-14-8-4-5-9-14)11-6-2-1-3-7-11/h1-2,5-8,11H,3-4,9-10,12H2;1-5H,6-10H2;1-3,6-7H,4-5,8-10H2/q3*+1 |
| InChIKey | AHSWGXCPJXTDKB-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.01 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|